CAS 111043-01-7 is the registry number for Methyl 3-hydroxythieno(2,3-b)pyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate (CAS 111043-01-7) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: methyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate. InChIKey: VNGMVGWUWHNBBW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | methyl 3-hydroxythieno[2,3-b]pyridine-2-carboxylate |
| InChIKey | VNGMVGWUWHNBBW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(S1)N=CC=C2)O |
Computed by PubChem (NCBI)