Products 1111108-95-2
CAS 1111108-95-2 appears in our catalog under these names: 5-(3-Carboxyphenyl)-2-hydroxypyrimidine, 95%, 5-(3-Carboxyphenyl)-2-hydroxypyrimidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,1g, 0,05g, 0,25g, 0,5g.
3-(2-oxo-1H-pyrimidin-5-yl)benzoic acid (CAS 1111108-95-2) is a chemical compound with the molecular formula C11H8N2O3 and a molecular weight of 216.19 g/mol. IUPAC name: 3-(2-oxo-1H-pyrimidin-5-yl)benzoic acid. InChIKey: OQBIJKSTMQOQND-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O3 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | 3-(2-oxo-1H-pyrimidin-5-yl)benzoic acid |
| InChIKey | OQBIJKSTMQOQND-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CNC(=O)N=C2 |
Computed by PubChem (NCBI)