Products 1112179-55-1

CAS 1112179-55-1 is the registry number for 1,4-dioxane-2,5-dicarboxylic acid, 2-methyl ester, (2r,5s)-rel-, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

(2S,5R)-5-methoxycarbonyl-1,4-dioxane-2-carboxylic acid (CAS 1112179-55-1) is a chemical compound with the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. IUPAC name: (2S,5R)-5-methoxycarbonyl-1,4-dioxane-2-carboxylic acid. InChIKey: FRGYPQYDYKJZRN-CRCLSJGQSA-N.

Identity
Molecular formulaC7H10O6
Molecular weight190.15 g/mol
IUPAC name(2S,5R)-5-methoxycarbonyl-1,4-dioxane-2-carboxylic acid
InChIKeyFRGYPQYDYKJZRN-CRCLSJGQSA-N
SMILESCOC(=O)[C@H]1CO[C@@H](CO1)C(=O)O

Computed by PubChem (NCBI)