CAS 39701-84-3 is the registry number for Methyl 2-(S)-Acetoxy-3-carboxypropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-acetyloxy-4-methoxy-4-oxobutanoic acid (CAS 39701-84-3) is a chemical compound with the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. IUPAC name: (3S)-3-acetyloxy-4-methoxy-4-oxobutanoic acid. InChIKey: DQUIKZDAUFIOEL-YFKPBYRVSA-N.
| Molecular formula | C7H10O6 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | (3S)-3-acetyloxy-4-methoxy-4-oxobutanoic acid |
| InChIKey | DQUIKZDAUFIOEL-YFKPBYRVSA-N |
| SMILES | CC(=O)O[C@@H](CC(=O)O)C(=O)OC |
Computed by PubChem (NCBI)