Products 126581-14-4
CAS 126581-14-4 is the registry number for (4S,5S)-2,2-Dimethyl-1,3-dioxolane-4,5-dicarboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylic acid (CAS 126581-14-4) is a chemical compound with the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. IUPAC name: (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylic acid. InChIKey: ZJRYLTPWHABKIT-IMJSIDKUSA-N.
| Molecular formula | C7H10O6 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | (4S,5S)-2,2-dimethyl-1,3-dioxolane-4,5-dicarboxylic acid |
| InChIKey | ZJRYLTPWHABKIT-IMJSIDKUSA-N |
| SMILES | CC1(O[C@@H]([C@H](O1)C(=O)O)C(=O)O)C |
Computed by PubChem (NCBI)