Products 1822990-18-0

CAS 1822990-18-0 is the registry number for 5-(Methoxycarbonyl)-1,4-dioxane-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methoxycarbonyl-1,4-dioxane-2-carboxylic acid (CAS 1822990-18-0) is a chemical compound with the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. IUPAC name: 5-methoxycarbonyl-1,4-dioxane-2-carboxylic acid. InChIKey: FRGYPQYDYKJZRN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10O6
Molecular weight190.15 g/mol
IUPAC name5-methoxycarbonyl-1,4-dioxane-2-carboxylic acid
InChIKeyFRGYPQYDYKJZRN-UHFFFAOYSA-N
SMILESCOC(=O)C1COC(CO1)C(=O)O

Computed by PubChem (NCBI)