CAS 31718-88-4 is the registry number for Methyl-4-deoxy-a-L-threo-hex-4-enopyranosiduronic acid. Offered by: Biosynth. Available pack sizes: 2g, 1g.
(2R,3R,4S)-3,4-dihydroxy-2-methoxy-3,4-dihydro-2H-pyran-6-carboxylic acid (CAS 31718-88-4) is a chemical compound with the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. IUPAC name: (2R,3R,4S)-3,4-dihydroxy-2-methoxy-3,4-dihydro-2H-pyran-6-carboxylic acid. InChIKey: ILDQSDKXCLSHSM-JLEYCGRDSA-N.
| Molecular formula | C7H10O6 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | (2R,3R,4S)-3,4-dihydroxy-2-methoxy-3,4-dihydro-2H-pyran-6-carboxylic acid |
| InChIKey | ILDQSDKXCLSHSM-JLEYCGRDSA-N |
| SMILES | CO[C@H]1[C@@H]([C@H](C=C(O1)C(=O)O)O)O |
Computed by PubChem (NCBI)