Products 111254-18-3
CAS 111254-18-3 appears in our catalog under these names: Episappanol, Episappanol, 98.57%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 1mg, 5 mg, 1 mg, 5mg.
(3R,4R)-3-[(3,4-dihydroxyphenyl)methyl]-2,4-dihydrochromene-3,4,7-triol (CAS 111254-18-3) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: (3R,4R)-3-[(3,4-dihydroxyphenyl)methyl]-2,4-dihydrochromene-3,4,7-triol. InChIKey: MPGFEHZDABUJFR-HZPDHXFCSA-N.
| Molecular formula | C16H16O6 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | (3R,4R)-3-[(3,4-dihydroxyphenyl)methyl]-2,4-dihydrochromene-3,4,7-triol |
| InChIKey | MPGFEHZDABUJFR-HZPDHXFCSA-N |
| SMILES | C1[C@@]([C@@H](C2=C(O1)C=C(C=C2)O)O)(CC3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)