Products 1112977-84-0
CAS 1112977-84-0 appears in our catalog under these names: DAz–1, DAz-1. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1 mg, 10 mg, 5 mg.
N-(3-azidopropyl)-3,5-dioxocyclohexane-1-carboxamide (CAS 1112977-84-0) is a chemical compound with the molecular formula C10H14N4O3 and a molecular weight of 238.24 g/mol. IUPAC name: N-(3-azidopropyl)-3,5-dioxocyclohexane-1-carboxamide. InChIKey: ZMZUOTZOCOMDDO-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | N-(3-azidopropyl)-3,5-dioxocyclohexane-1-carboxamide |
| InChIKey | ZMZUOTZOCOMDDO-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)CC1=O)C(=O)NCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)