CAS 956265-77-3 is the registry number for N-Cyclopropyl-2-(3,5-dimethyl-4-nitro-1H-pyrazol-1-yl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-cyclopropyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (CAS 956265-77-3) is a chemical compound with the molecular formula C10H14N4O3 and a molecular weight of 238.24 g/mol. IUPAC name: N-cyclopropyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide. InChIKey: CXMOUYNWCFTNIO-UHFFFAOYSA-N.
| Molecular formula | C10H14N4O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | N-cyclopropyl-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| InChIKey | CXMOUYNWCFTNIO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC(=O)NC2CC2)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)