CAS 86540-96-7 is the registry number for (R)-Proxyphylline. Offered by: Chemat Brand. Available pack sizes: on request.
7-[(2R)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione (CAS 86540-96-7) is a chemical compound with the molecular formula C10H14N4O3 and a molecular weight of 238.24 g/mol. IUPAC name: 7-[(2R)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione. InChIKey: KYHQZNGJUGFTGR-ZCFIWIBFSA-N.
| Molecular formula | C10H14N4O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 7-[(2R)-2-hydroxypropyl]-1,3-dimethylpurine-2,6-dione |
| InChIKey | KYHQZNGJUGFTGR-ZCFIWIBFSA-N |
| SMILES | C[C@H](CN1C=NC2=C1C(=O)N(C(=O)N2C)C)O |
Computed by PubChem (NCBI)