CAS 201047-84-9 appears in our catalog under these names: H-Orn(pyrazinylcarbonyl)-oh, 95%, (S)-2-Amino-5-(pyrazine-2-carboxamido)pentanoic acid, 97%, Nd-Pyrazinylcarbonyl-L-ornithine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 500mg.
(2S)-2-amino-5-(pyrazine-2-carbonylamino)pentanoic acid (CAS 201047-84-9) is a chemical compound with the molecular formula C10H14N4O3 and a molecular weight of 238.24 g/mol. IUPAC name: (2S)-2-amino-5-(pyrazine-2-carbonylamino)pentanoic acid. InChIKey: GJGIGJGNECGMMN-ZETCQYMHSA-N.
| Molecular formula | C10H14N4O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | (2S)-2-amino-5-(pyrazine-2-carbonylamino)pentanoic acid |
| InChIKey | GJGIGJGNECGMMN-ZETCQYMHSA-N |
| SMILES | C1=CN=C(C=N1)C(=O)NCCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)