CAS 556020-47-4 is the registry number for N'-(3-Ethyl-5-formyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)-N,N-dimethylmethanimidamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N'-(3-ethyl-5-formyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide (CAS 556020-47-4) is a chemical compound with the molecular formula C10H14N4O3 and a molecular weight of 238.24 g/mol. IUPAC name: N'-(3-ethyl-5-formyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide. InChIKey: LTINBIANJVSXLN-IZZDOVSWSA-N.
| Molecular formula | C10H14N4O3 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | N'-(3-ethyl-5-formyl-2,6-dioxopyrimidin-4-yl)-N,N-dimethylmethanimidamide |
| InChIKey | LTINBIANJVSXLN-IZZDOVSWSA-N |
| SMILES | CCN1C(=C(C(=O)NC1=O)C=O)/N=C/N(C)C |
Computed by PubChem (NCBI)