CAS 1112994-35-0 appears in our catalog under these names: P-2281, 98%, P-2281/ 99.95% (existing batch purity), P–2281, P-2281 99%, 2-chloro-N-(6-cyanopyridin-3-yl)propanamide, 99%, 99%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 25 mg.
2-chloro-N-(6-cyano-3-pyridinyl)propanamide (CAS 1112994-35-0) is a chemical compound with the molecular formula C9H8ClN3O and a molecular weight of 209.63 g/mol. IUPAC name: 2-chloro-N-(6-cyano-3-pyridinyl)propanamide. InChIKey: VFOLQYOVUCHHET-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 2-chloro-N-(6-cyano-3-pyridinyl)propanamide |
| InChIKey | VFOLQYOVUCHHET-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CN=C(C=C1)C#N)Cl |
Computed by PubChem (NCBI)