CAS 1113001-63-0 appears in our catalog under these names: 2-(3-(Methoxycarbonyl)bicyclo[1.1.1]pentan-1-yl)acetic acid, 95%, 2-(3-methoxycarbonyl-1-bicyclo(1.1.1)pentanyl)acetic acid, 97%, 2-(3-(methoxycarbonyl)bicyclo(1.1.1)pentan-1-yl)acetic acid, 2-(3-(Methoxycarbonyl)bicyclo-[1.1.1]pentan-1-yl)acetic acid, 95%, 95%, 2-[3-(Methoxycarbonyl)bicyclo[1.1.1]pentan-1-yl]acetic acid, 98.0%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 100mg, 5g, 0,5g, 50mg, 500mg, 500 mg.
2-(3-methoxycarbonyl-1-bicyclo[1.1.1]pentanyl)acetic acid (CAS 1113001-63-0) is a chemical compound with the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. IUPAC name: 2-(3-methoxycarbonyl-1-bicyclo[1.1.1]pentanyl)acetic acid. InChIKey: LUHZDMKRIAUCOY-UHFFFAOYSA-N.
| Molecular formula | C9H12O4 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-(3-methoxycarbonyl-1-bicyclo[1.1.1]pentanyl)acetic acid |
| InChIKey | LUHZDMKRIAUCOY-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(C2)CC(=O)O |
Computed by PubChem (NCBI)