CAS 111304-30-4 is the registry number for Nitrendipine Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate (CAS 111304-30-4) is a chemical compound with the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. IUPAC name: ethyl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate. InChIKey: YOPMSDPIOQUWFE-XYOKQWHBSA-N.
| Molecular formula | C13H13NO5 |
|---|---|
| Molecular weight | 263.25 g/mol |
| IUPAC name | ethyl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate |
| InChIKey | YOPMSDPIOQUWFE-XYOKQWHBSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC(=CC=C1)[N+](=O)[O-])/C(=O)C |
Computed by PubChem (NCBI)