CAS 1113049-82-3 is the registry number for 4-Chloro-5-hydroxy-2-nitrobenzoic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 10mg, 250mg, 50mg.
Methyl 4-chloro-5-hydroxy-2-nitrobenzoate (CAS 1113049-82-3) is a chemical compound with the molecular formula C8H6ClNO5 and a molecular weight of 231.59 g/mol. IUPAC name: methyl 4-chloro-5-hydroxy-2-nitrobenzoate. InChIKey: GTEUEIXVJRNYIO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO5 |
|---|---|
| Molecular weight | 231.59 g/mol |
| IUPAC name | methyl 4-chloro-5-hydroxy-2-nitrobenzoate |
| InChIKey | GTEUEIXVJRNYIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1[N+](=O)[O-])Cl)O |
Computed by PubChem (NCBI)