Products 1114339-55-7
CAS 1114339-55-7 is the registry number for 2-phenyl-4-(1-(2,4,6-trimethoxyphenyl)methylidene)-4H-oxazol-5-one, 90%, 90%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-phenyl-4-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one (CAS 1114339-55-7) is a chemical compound with the molecular formula C19H17NO5 and a molecular weight of 339.3 g/mol. IUPAC name: 2-phenyl-4-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one. InChIKey: GXMHJECILVOPIL-UHFFFAOYSA-N.
| Molecular formula | C19H17NO5 |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 2-phenyl-4-[(2,4,6-trimethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| InChIKey | GXMHJECILVOPIL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C=C2C(=O)OC(=N2)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)