CAS 909344-66-7 is the registry number for 2,2-dimethyl-5-(((4-phenoxyphenyl)amino)methylene)-1,3-dioxane-4,6-dione. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
2,2-dimethyl-5-[(4-phenoxyanilino)methylidene]-1,3-dioxane-4,6-dione (CAS 909344-66-7) is a chemical compound with the molecular formula C19H17NO5 and a molecular weight of 339.3 g/mol. IUPAC name: 2,2-dimethyl-5-[(4-phenoxyanilino)methylidene]-1,3-dioxane-4,6-dione. InChIKey: ALCMJIOZTDHDEG-UHFFFAOYSA-N.
| Molecular formula | C19H17NO5 |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 2,2-dimethyl-5-[(4-phenoxyanilino)methylidene]-1,3-dioxane-4,6-dione |
| InChIKey | ALCMJIOZTDHDEG-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CNC2=CC=C(C=C2)OC3=CC=CC=C3)C(=O)O1)C |
Computed by PubChem (NCBI)