Products 302575-69-5

CAS 302575-69-5 is the registry number for 2-(3,4,5-Trimethoxyphenyl)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylic acid (CAS 302575-69-5) is a chemical compound with the molecular formula C19H17NO5 and a molecular weight of 339.3 g/mol. IUPAC name: 2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylic acid. InChIKey: HSUYVVQQTJCCFA-UHFFFAOYSA-N.

Identity
Molecular formulaC19H17NO5
Molecular weight339.3 g/mol
IUPAC name2-(3,4,5-trimethoxyphenyl)quinoline-4-carboxylic acid
InChIKeyHSUYVVQQTJCCFA-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)OC)C2=NC3=CC=CC=C3C(=C2)C(=O)O

Computed by PubChem (NCBI)