CAS 2044773-70-6 appears in our catalog under these names: 1-{((9H-fluoren-9-yl)methoxy)carbonyl}-3-hydroxyazetidine-3-carboxylic acid, 95%, 1-{((9H-Fluoren-9-yl)methoxy)carbonyl}-3-hydroxyazetidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
1-(9H-fluoren-9-ylmethoxycarbonyl)-3-hydroxyazetidine-3-carboxylic acid (CAS 2044773-70-6) is a chemical compound with the molecular formula C19H17NO5 and a molecular weight of 339.3 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-hydroxyazetidine-3-carboxylic acid. InChIKey: QLCBWAPLQFXHRG-UHFFFAOYSA-N.
| Molecular formula | C19H17NO5 |
|---|---|
| Molecular weight | 339.3 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-3-hydroxyazetidine-3-carboxylic acid |
| InChIKey | QLCBWAPLQFXHRG-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)(C(=O)O)O |
Computed by PubChem (NCBI)