Products 111479-04-0
CAS 111479-04-0 is the registry number for Z-Antiepilepsirine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(Z)-3-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylprop-2-en-1-one (CAS 111479-04-0) is a chemical compound with the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. IUPAC name: (Z)-3-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylprop-2-en-1-one. InChIKey: BLPUOQGPBJPXRL-ALCCZGGFSA-N.
| Molecular formula | C15H17NO3 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | (Z)-3-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylprop-2-en-1-one |
| InChIKey | BLPUOQGPBJPXRL-ALCCZGGFSA-N |
| SMILES | C1CCN(CC1)C(=O)/C=C\C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)