CAS 1114822-69-3 appears in our catalog under these names: 2-Bromo-5-methoxybenzene-1-carbothioamide, 95%, 2-Bromo-5-methoxybenzene-1-carbothioamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-bromo-5-methoxybenzenecarbothioamide (CAS 1114822-69-3) is a chemical compound with the molecular formula C8H8BrNOS and a molecular weight of 246.13 g/mol. IUPAC name: 2-bromo-5-methoxybenzenecarbothioamide. InChIKey: HJNMFXMNMSKPPG-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNOS |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 2-bromo-5-methoxybenzenecarbothioamide |
| InChIKey | HJNMFXMNMSKPPG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)C(=S)N |
Computed by PubChem (NCBI)