Products 92336-11-3
CAS 92336-11-3 is the registry number for 2-Bromo-5,6,7,8-tetrahydro-4H-thieno(3,2-c)azepin-4-one, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-bromo-5,6,7,8-tetrahydrothieno[3,2-c]azepin-4-one (CAS 92336-11-3) is a chemical compound with the molecular formula C8H8BrNOS and a molecular weight of 246.13 g/mol. IUPAC name: 2-bromo-5,6,7,8-tetrahydrothieno[3,2-c]azepin-4-one. InChIKey: AHGGZYAEMZORKU-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNOS |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 2-bromo-5,6,7,8-tetrahydrothieno[3,2-c]azepin-4-one |
| InChIKey | AHGGZYAEMZORKU-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(S2)Br)C(=O)NC1 |
Computed by PubChem (NCBI)