Products 1368146-68-2
CAS 1368146-68-2 is the registry number for 2-Bromo-6,7-dihydro-4H-thieno[2,3-c]azepin-8(5H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4,5,6,7-tetrahydrothieno[2,3-c]azepin-8-one (CAS 1368146-68-2) is a chemical compound with the molecular formula C8H8BrNOS and a molecular weight of 246.13 g/mol. IUPAC name: 2-bromo-4,5,6,7-tetrahydrothieno[2,3-c]azepin-8-one. InChIKey: OWFORQPUZTYUAE-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNOS |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 2-bromo-4,5,6,7-tetrahydrothieno[2,3-c]azepin-8-one |
| InChIKey | OWFORQPUZTYUAE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)NC1)SC(=C2)Br |
Computed by PubChem (NCBI)