CAS 2548984-92-3 is the registry number for 3-Bromo-5-(methylsulfanyl)benzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
3-bromo-5-methylsulfanylbenzamide (CAS 2548984-92-3) is a chemical compound with the molecular formula C8H8BrNOS and a molecular weight of 246.13 g/mol. IUPAC name: 3-bromo-5-methylsulfanylbenzamide. InChIKey: PAQCRFSUCGYTTA-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNOS |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 3-bromo-5-methylsulfanylbenzamide |
| InChIKey | PAQCRFSUCGYTTA-UHFFFAOYSA-N |
| SMILES | CSC1=CC(=CC(=C1)C(=O)N)Br |
Computed by PubChem (NCBI)