Products 2649070-11-9
CAS 2649070-11-9 is the registry number for 5-Bromo-1-methyl-3H-1l4-benzo(d)isothiazole 1-oxide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
5-bromo-1-methyl-3H-1,2-benzothiazole 1-oxide (CAS 2649070-11-9) is a chemical compound with the molecular formula C8H8BrNOS and a molecular weight of 246.13 g/mol. IUPAC name: 5-bromo-1-methyl-3H-1,2-benzothiazole 1-oxide. InChIKey: SAVFGEKSJJCJEE-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNOS |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 5-bromo-1-methyl-3H-1,2-benzothiazole 1-oxide |
| InChIKey | SAVFGEKSJJCJEE-UHFFFAOYSA-N |
| SMILES | CS1(=NCC2=C1C=CC(=C2)Br)=O |
Computed by PubChem (NCBI)