CAS 1114822-80-8 is the registry number for 4,6-Dimethyl-1H-pyrrolo(2,3-b)pyridine-3-carbonitrile, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile (CAS 1114822-80-8) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile. InChIKey: XTLLTHLIRILPMH-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-3-carbonitrile |
| InChIKey | XTLLTHLIRILPMH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=CN2)C#N)C |
Computed by PubChem (NCBI)