CAS 111537-41-8 is the registry number for 3',5-Dihydroxy-4',5',6,7-tetramethoxyflavone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6,7-dimethoxychromen-4-one (CAS 111537-41-8) is a chemical compound with the molecular formula C19H18O8 and a molecular weight of 374.3 g/mol. IUPAC name: 5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6,7-dimethoxychromen-4-one. InChIKey: WVDMIOIJGFCRJQ-UHFFFAOYSA-N.
| Molecular formula | C19H18O8 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 5-hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6,7-dimethoxychromen-4-one |
| InChIKey | WVDMIOIJGFCRJQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)O)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)OC)O |
Computed by PubChem (NCBI)