CAS 68710-17-8 is the registry number for Arteanoflavone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 5 mg, 1 mg.
5,7-dihydroxy-6-methoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (CAS 68710-17-8) is a chemical compound with the molecular formula C19H18O8 and a molecular weight of 374.3 g/mol. IUPAC name: 5,7-dihydroxy-6-methoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one. InChIKey: ZHESTCBHMHKZNL-UHFFFAOYSA-N.
| Molecular formula | C19H18O8 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 5,7-dihydroxy-6-methoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| InChIKey | ZHESTCBHMHKZNL-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=CC(=O)C3=C(O2)C=C(C(=C3O)OC)O |
Computed by PubChem (NCBI)