Products 50461-86-4
CAS 50461-86-4 is the registry number for Araneosol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 1 mg, 10 mg, 5 mg.
5,7-dihydroxy-3,6,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 50461-86-4) is a chemical compound with the molecular formula C19H18O8 and a molecular weight of 374.3 g/mol. IUPAC name: 5,7-dihydroxy-3,6,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: UZIFGCHUAVTVIL-UHFFFAOYSA-N.
| Molecular formula | C19H18O8 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 5,7-dihydroxy-3,6,8-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | UZIFGCHUAVTVIL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C(=C(C(=C3O2)OC)O)OC)O)OC |
Computed by PubChem (NCBI)