Products 63296-15-1
CAS 63296-15-1 appears in our catalog under these names: 5，6–Dihydroxy–3，7，3'，4'–tetramethoxyflavone, 5,6-Dihydroxy-3,7,3',4'-tetramethoxyflavone. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
2-(3,4-dimethoxyphenyl)-5,6-dihydroxy-3,7-dimethoxychromen-4-one (CAS 63296-15-1) is a chemical compound with the molecular formula C19H18O8 and a molecular weight of 374.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-5,6-dihydroxy-3,7-dimethoxychromen-4-one. InChIKey: DXEKSOHHLFZGKA-UHFFFAOYSA-N.
| Molecular formula | C19H18O8 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-5,6-dihydroxy-3,7-dimethoxychromen-4-one |
| InChIKey | DXEKSOHHLFZGKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)O)O)OC)OC |
Computed by PubChem (NCBI)