CAS 206358-02-3 is the registry number for 5,7-Dihydroxy-2',3',4',5'-tetramethoxyflavone. Offered by: Biosynth. Available pack sizes: 0,5mg.
5,7-dihydroxy-2-(2,3,4,5-tetramethoxyphenyl)chromen-4-one (CAS 206358-02-3) is a chemical compound with the molecular formula C19H18O8 and a molecular weight of 374.3 g/mol. IUPAC name: 5,7-dihydroxy-2-(2,3,4,5-tetramethoxyphenyl)chromen-4-one. InChIKey: ZYVBPTWKKGRSOZ-UHFFFAOYSA-N.
| Molecular formula | C19H18O8 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 5,7-dihydroxy-2-(2,3,4,5-tetramethoxyphenyl)chromen-4-one |
| InChIKey | ZYVBPTWKKGRSOZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C2=CC(=O)C3=C(C=C(C=C3O2)O)O)OC)OC)OC |
Computed by PubChem (NCBI)