Products 1115962-75-8
CAS 1115962-75-8 is the registry number for 6-(Dimethylsulfamoyl)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-(dimethylsulfamoyl)pyridine-3-carboxylic acid (CAS 1115962-75-8) is a chemical compound with the molecular formula C8H10N2O4S and a molecular weight of 230.24 g/mol. IUPAC name: 6-(dimethylsulfamoyl)pyridine-3-carboxylic acid. InChIKey: DZCJKFFQXFGSDP-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O4S |
|---|---|
| Molecular weight | 230.24 g/mol |
| IUPAC name | 6-(dimethylsulfamoyl)pyridine-3-carboxylic acid |
| InChIKey | DZCJKFFQXFGSDP-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)