Products 111649-72-0
CAS 111649-72-0 appears in our catalog under these names: 2-Acetamido-3-(4-fluorophenyl)acrylic acid, 98%, p-Fluoro-Alpha-acetamidocinnamic Acid, >95% (HPLC), p-Fluoro-a-acetamidocinnamic Acid, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 10g, 1g, 5g.
2-acetamido-3-(4-fluorophenyl)prop-2-enoic acid (CAS 111649-72-0) is a chemical compound with the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. IUPAC name: 2-acetamido-3-(4-fluorophenyl)prop-2-enoic acid. InChIKey: PYGHVJGHLGZANA-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO3 |
|---|---|
| Molecular weight | 223.20 g/mol |
| IUPAC name | 2-acetamido-3-(4-fluorophenyl)prop-2-enoic acid |
| InChIKey | PYGHVJGHLGZANA-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(=CC1=CC=C(C=C1)F)C(=O)O |
Computed by PubChem (NCBI)