CAS 1116681-98-1 appears in our catalog under these names: 4-Chloro-2,3-difluorophenylboronic acid, pinacol ester, 98%, 98%, 4-Chloro-2,3-difluorophenylboronic acid, pinacol ester, 98%, 2-(4-Chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g.
2-(4-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1116681-98-1) is a chemical compound with the molecular formula C12H14BClF2O2 and a molecular weight of 274.50 g/mol. IUPAC name: 2-(4-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: KERWHSMECDFMFY-UHFFFAOYSA-N.
| Molecular formula | C12H14BClF2O2 |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 2-(4-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | KERWHSMECDFMFY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)Cl)F)F |
Computed by PubChem (NCBI)