CAS 2121514-33-6 appears in our catalog under these names: 2,3-Difluoro-6-chlorophenylboronic acid pinacol ester, 95%, 2,3-Difluoro-6-chlorophenylboronic acid pinacol ester, ≥95%, ≥95%, 2,3-Difluoro-6-chlorophenylboronic acid pinacol ester, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
2-(6-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-33-6) is a chemical compound with the molecular formula C12H14BClF2O2 and a molecular weight of 274.50 g/mol. IUPAC name: 2-(6-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HFQQULQLTDSDRG-UHFFFAOYSA-N.
| Molecular formula | C12H14BClF2O2 |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 2-(6-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HFQQULQLTDSDRG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)F)Cl |
Computed by PubChem (NCBI)