CAS 2246586-13-8 appears in our catalog under these names: 5-Chloro-2,3-difluorophenylboronic acid pinacol ester, 95%, 5-Chloro-2,3-difluorophenylboronic acid pinacol ester, 95%, 95%, 2-(5-Chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g.
2-(5-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2246586-13-8) is a chemical compound with the molecular formula C12H14BClF2O2 and a molecular weight of 274.50 g/mol. IUPAC name: 2-(5-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MKDFAVKAJNKOJD-UHFFFAOYSA-N.
| Molecular formula | C12H14BClF2O2 |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 2-(5-chloro-2,3-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MKDFAVKAJNKOJD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)F)Cl |
Computed by PubChem (NCBI)