CAS 1126320-24-8 appears in our catalog under these names: 2-(4-Chloro-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 2-(4-Chloro-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 98%, 4-Chloro-2,5-difluorophenylboronic acid pinacol ester, 99.66%. Offered by: Combi-blocks, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg, 250 mg, 100 mg.
2-(4-chloro-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1126320-24-8) is a chemical compound with the molecular formula C12H14BClF2O2 and a molecular weight of 274.50 g/mol. IUPAC name: 2-(4-chloro-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OJERJYBDUGRDKV-UHFFFAOYSA-N.
| Molecular formula | C12H14BClF2O2 |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 2-(4-chloro-2,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OJERJYBDUGRDKV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)Cl)F |
Computed by PubChem (NCBI)