CAS 2121514-02-9 appears in our catalog under these names: 2-Chloro-4,5-difluorophenylboronic acid, pinacol ester, 95%, 2-Chloro-4,5-difluorophenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(2-chloro-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-02-9) is a chemical compound with the molecular formula C12H14BClF2O2 and a molecular weight of 274.50 g/mol. IUPAC name: 2-(2-chloro-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JMRMQKLNWZBIEO-UHFFFAOYSA-N.
| Molecular formula | C12H14BClF2O2 |
|---|---|
| Molecular weight | 274.50 g/mol |
| IUPAC name | 2-(2-chloro-4,5-difluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JMRMQKLNWZBIEO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2Cl)F)F |
Computed by PubChem (NCBI)