CAS 1117-51-7 is the registry number for Teprenone Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
(5Z,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one (CAS 1117-51-7) is a chemical compound with the molecular formula C18H30O and a molecular weight of 262.4 g/mol. IUPAC name: (5Z,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one. InChIKey: LTUMRKDLVGQMJU-ADPXBSPTSA-N.
| Molecular formula | C18H30O |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | (5Z,9E)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one |
| InChIKey | LTUMRKDLVGQMJU-ADPXBSPTSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C\CCC(=O)C)/C)/C)C |
Computed by PubChem (NCBI)