CAS 732-26-3 appears in our catalog under these names: 2,4,6-Tri-tert-butylphenol, 98%, 2,4,6-Tri-tert-butylphenol, 2,4,6-Tri-tert-butylphenol, >95% (GC), 2,4,6–Tri–tert–butyl phenol, 2,4,6-Tri-tert-butylphenol, 97%. Offered by: Combi-blocks, Dr. Ehrenstorfer, TRC, GLPBio, Thermo Scientific (Acros). Available pack sizes: 1kg, 500g, 25g, 100g, 5g, 250mg, 10g, 1g.
2,4,6-tritert-butylphenol (CAS 732-26-3) is a chemical compound with the molecular formula C18H30O and a molecular weight of 262.4 g/mol. IUPAC name: 2,4,6-tritert-butylphenol. InChIKey: PFEFOYRSMXVNEL-UHFFFAOYSA-N.
| Molecular formula | C18H30O |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 2,4,6-tritert-butylphenol |
| InChIKey | PFEFOYRSMXVNEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)