Products 3796-69-8
CAS 3796-69-8 is the registry number for Teprenone Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.
(5Z,9Z)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one (CAS 3796-69-8) is a chemical compound with the molecular formula C18H30O and a molecular weight of 262.4 g/mol. IUPAC name: (5Z,9Z)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one. InChIKey: LTUMRKDLVGQMJU-VHSABMJYSA-N.
| Molecular formula | C18H30O |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | (5Z,9Z)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one |
| InChIKey | LTUMRKDLVGQMJU-VHSABMJYSA-N |
| SMILES | CC(=CCC/C(=C\CC/C(=C\CCC(=O)C)/C)/C)C |
Computed by PubChem (NCBI)
Synonyms:
(5Z,9Z)-6,10,14-trimethylpentadeca-5,9,13-trien-2-one, cis,cis-Farnesylacetone, Farnesyl acetone, (5Z,9Z)-, FEMA No. 3442, (5Z,9Z)-, 5,9,13-Pentadecatrien-2-one, 6,10,14-trimethyl-, (Z,Z)-, 5,9,13-Pentadecatrien-2-one, 6,10,14-trimethyl-, (5Z,9Z)-, (z,z)-farnesylacetone, (5Z,9Z)-farnesyl acetone, LTUMRKDLVGQMJU-VHSABMJYSA-N