CAS 17540-75-9 appears in our catalog under these names: 4–sec–Butyl–2,6–di–tert–butylphenol, 4-sec-Butyl-2,6-di-tert-butylphenol, >98.0%(GC), 2,6-Di-tert-butyl-4-sec-butylphenol, 98%, 98%, 4-SEC-BUTYL-2,6-DI-TERT-BUTYLPHENOL, 96%, 4-sec-Butyl-2,6-di-tert-butylphenol, ≥98%(GC). Offered by: GLPBio, TCI, Chemat, Sigma-Aldrich, Fluorochem. Available pack sizes: 500g, 25g, 5g, 100g, 50g, 1L.
4-butan-2-yl-2,6-ditert-butylphenol (CAS 17540-75-9) is a chemical compound with the molecular formula C18H30O and a molecular weight of 262.4 g/mol. IUPAC name: 4-butan-2-yl-2,6-ditert-butylphenol. InChIKey: BFZOTKYPSZSDEV-UHFFFAOYSA-N.
| Molecular formula | C18H30O |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 4-butan-2-yl-2,6-ditert-butylphenol |
| InChIKey | BFZOTKYPSZSDEV-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)