CAS 147441-44-9 is the registry number for 2-(tert-Butoxy)-1,3-di-tert-butylbenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-ditert-butyl-2-[(2-methylpropan-2-yl)oxy]benzene (CAS 147441-44-9) is a chemical compound with the molecular formula C18H30O and a molecular weight of 262.4 g/mol. IUPAC name: 1,3-ditert-butyl-2-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: WJHGMRJZWRUDPX-UHFFFAOYSA-N.
| Molecular formula | C18H30O |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 1,3-ditert-butyl-2-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | WJHGMRJZWRUDPX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=CC=C1)C(C)(C)C)OC(C)(C)C |
Computed by PubChem (NCBI)