CAS 111771-13-2 appears in our catalog under these names: 2-Bromo-5-fluorobenzoylchloride, 95%, 2-Bromo-5-fluorobenzoyl chloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 25g, 10g, 1g, 100g, 5g.
2-bromo-5-fluorobenzoyl chloride (CAS 111771-13-2) is a chemical compound with the molecular formula C7H3BrClFO and a molecular weight of 237.45 g/mol. IUPAC name: 2-bromo-5-fluorobenzoyl chloride. InChIKey: QIFDGTIOMAVGAQ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClFO |
|---|---|
| Molecular weight | 237.45 g/mol |
| IUPAC name | 2-bromo-5-fluorobenzoyl chloride |
| InChIKey | QIFDGTIOMAVGAQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)Cl)Br |
Computed by PubChem (NCBI)