CAS 111771-58-5 appears in our catalog under these names: Boc-alpha-methyl-L-phenylalanine, 98%, (R)–2–((tert–Butoxycarbonyl)amino)–2–methyl–3–phenylpropanoic acid, (R)-2-[(tert-Butoxycarbonyl)amino]-2-methyl-3-phenylpropionic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg, 10g.
(2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 111771-58-5) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: FAXPKABRZLISKX-OAHLLOKOSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | FAXPKABRZLISKX-OAHLLOKOSA-N |
| SMILES | C[C@@](CC1=CC=CC=C1)(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)