CAS 53940-88-8 appears in our catalog under these names: Boc-alpha-methyl-d-phe, 98%, Boc–α–methyl–D–phenylalanine, Boc-alpha-Me-L-Phe-OH, (S)-2-((tert-Butoxycarbonyl)amino)-2-methyl-3-phenylpropanoic acid, 95%, 95%, (R)-2-((tert-Butoxycarbonyl)amino)-2-methyl-3-phenylpropanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25mg, 5g, 100mg.
(2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 53940-88-8) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: FAXPKABRZLISKX-OAHLLOKOSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2R)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | FAXPKABRZLISKX-OAHLLOKOSA-N |
| SMILES | C[C@@](CC1=CC=CC=C1)(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)