Products 111852-42-7

CAS 111852-42-7 is the registry number for 2-(4-Bromophenyl)oxazolo[4,5-b]pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

2-(4-bromophenyl)-[1,3]oxazolo[4,5-b]pyridine (CAS 111852-42-7) is a chemical compound with the molecular formula C12H7BrN2O and a molecular weight of 275.10 g/mol. IUPAC name: 2-(4-bromophenyl)-[1,3]oxazolo[4,5-b]pyridine. InChIKey: XCVKDMYJJLCCJF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H7BrN2O
Molecular weight275.10 g/mol
IUPAC name2-(4-bromophenyl)-[1,3]oxazolo[4,5-b]pyridine
InChIKeyXCVKDMYJJLCCJF-UHFFFAOYSA-N
SMILESC1=CC2=C(N=C1)N=C(O2)C3=CC=C(C=C3)Br

Computed by PubChem (NCBI)