Products 929000-84-0
CAS 929000-84-0 is the registry number for 1-(4-Bromophenyl)-3-cyano-2(1H)-pyridinone, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(4-bromophenyl)-2-oxopyridine-3-carbonitrile (CAS 929000-84-0) is a chemical compound with the molecular formula C12H7BrN2O and a molecular weight of 275.10 g/mol. IUPAC name: 1-(4-bromophenyl)-2-oxopyridine-3-carbonitrile. InChIKey: ZSGIAEGBKSAEGM-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2O |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2-oxopyridine-3-carbonitrile |
| InChIKey | ZSGIAEGBKSAEGM-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)C#N)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)